Phenylbutazone

| CAS_number = 50-33-9 | ATC_prefix = M01 | ATC_suffix = AA01 | ATC_supplemental = | PubChem = 4781 | DrugBank_Ref = | DrugBank = DB00812 | ChemSpiderID_Ref = | ChemSpiderID = 4617 | UNII_Ref = | UNII = GN5P7K3T8S | KEGG_Ref = | KEGG = D00510 | ChEBI_Ref = | ChEBI = 48574 | ChEMBL_Ref = | ChEMBL = 101

| C=19 | H=20 | N=2 | O=2 | smiles = O=C2N(c1ccccc1)N(C(=O)C2CCCC)c3ccccc3 | StdInChI_Ref = | StdInChI = 1S/C19H20N2O2/c1-2-3-14-17-18(22)20(15-10-6-4-7-11-15)21(19(17)23)16-12-8-5-9-13-16/h4-13,17H,2-3,14H2,1H3 | StdInChIKey_Ref = | StdInChIKey = VYMDGNCVAMGZFE-UHFFFAOYSA-N }} Phenylbutazone, often referred to as "bute", is a nonsteroidal anti-inflammatory drug (NSAID) for the short-term treatment of pain and fever in animals.

In the United States and United Kingdom, it is no longer approved for human use (except in the United Kingdom for ankylosing spondylitis), as it can cause severe adverse effects such as suppression of white blood cell production and aplastic anemia. This drug was implicated in the 2013 meat adulteration scandal. Positive phenylbutazone tests in horse meat were uncommon in the UK, however. Provided by Wikipedia